C23H18N2O3 — CID 100998420
6-methyl-6-(4-methylphenyl)-9-oxa-3,5-diazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione (PubChem CID 100998420) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 6-methyl-6-(4-methylphenyl)-9-oxa-3,5-diazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione.
| Compound Name | 6-methyl-6-(4-methylphenyl)-9-oxa-3,5-diazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione |
|---|---|
| PubChem CID | 100998420 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 6-methyl-6-(4-methylphenyl)-9-oxa-3,5-diazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),11,13,15,17-hexaene-4,8-dione |
| SMILES | Cc1ccc(C2(C)NC(=O)Nc3c2c(=O)oc2c3ccc3ccccc32)cc1 |
| InChI | InChI=1S/C23H18N2O3/c1-13-7-10-15(11-8-13)23(2)18-19(24-22(27)25-23)17-12-9-14-5-3-4-6-16(14)20(17)28-21(18)26/h3-12H,1-2H3,(H2,24,25,27) |
| InChIKey | FEIVYYXXLWACSA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|