C19H20ClNO2 — CID 100999081
(1S,2R,5R,7R,10S,11R)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one (PubChem CID 100999081) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is (1S,2R,5R,7R,10S,11R)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one.
| Compound Name | (1S,2R,5R,7R,10S,11R)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one |
|---|---|
| PubChem CID | 100999081 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (1S,2R,5R,7R,10S,11R)-7-(4-chlorophenyl)-5-methyl-8-oxa-3-azatetracyclo[9.2.1.02,10.03,7]tetradec-12-en-4-one |
| SMILES | C[C@@H]1C[C@]2(c3ccc(Cl)cc3)OC[C@@H]3[C@@H]([C@@H]4C=C[C@H]3C4)N2C1=O |
| InChI | InChI=1S/C19H20ClNO2/c1-11-9-19(14-4-6-15(20)7-5-14)21(18(11)22)17-13-3-2-12(8-13)16(17)10-23-19/h2-7,11-13,16-17H,8-10H2,1H3/t11-,12+,13-,16+,17-,19-/m1/s1 |
| InChIKey | FGCDQPFQJMSDIM-PGIIFBBBSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|