C17H18ClNO2 — CID 606745
3a-(4-chlorophenyl)-3,5,5a,6,9,9a-hexahydro-2H-pyrrolo[1,2-a][3,1]benzoxazin-1-one (PubChem CID 606745) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is 3a-(4-chlorophenyl)-3,5,5a,6,9,9a-hexahydro-2H-pyrrolo[1,2-a][3,1]benzoxazin-1-one.
| Compound Name | 3a-(4-chlorophenyl)-3,5,5a,6,9,9a-hexahydro-2H-pyrrolo[1,2-a][3,1]benzoxazin-1-one |
|---|---|
| PubChem CID | 606745 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3a-(4-chlorophenyl)-3,5,5a,6,9,9a-hexahydro-2H-pyrrolo[1,2-a][3,1]benzoxazin-1-one |
| SMILES | O=C1CCC2(c3ccc(Cl)cc3)OCC3CC=CCC3N12 |
| InChI | InChI=1S/C17H18ClNO2/c18-14-7-5-13(6-8-14)17-10-9-16(20)19(17)15-4-2-1-3-12(15)11-21-17/h1-2,5-8,12,15H,3-4,9-11H2 |
| InChIKey | SCTNNTMNMQFXDV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|