C27H31BrN2O6 — CID 100999731
3-O-[2-(1-methyl-4H-pyridine-3-carbonyl)oxyethyl] 5-O-propan-2-yl 4-(3-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 100999731) has the molecular formula C27H31BrN2O6 and a molecular weight of 559.46 g/mol. Its IUPAC name is 3-O-[2-(1-methyl-4H-pyridine-3-carbonyl)oxyethyl] 5-O-propan-2-yl 4-(3-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[2-(1-methyl-4H-pyridine-3-carbonyl)oxyethyl] 5-O-propan-2-yl 4-(3-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 100999731 |
| Molecular Formula | C27H31BrN2O6 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 3-O-[2-(1-methyl-4H-pyridine-3-carbonyl)oxyethyl] 5-O-propan-2-yl 4-(3-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCOC(=O)C2=CN(C)C=CC2)C(c2cccc(Br)c2)C(C(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C27H31BrN2O6/c1-16(2)36-27(33)23-18(4)29-17(3)22(24(23)19-8-6-10-21(28)14-19)26(32)35-13-12-34-25(31)20-9-7-11-30(5)15-20/h6-8,10-11,14-16,24,29H,9,12-13H2,1-5H3 |
| InChIKey | QDXYJWXXXONDBE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|