C31H36N2O9 — CID 168649756
dimethyl 1-[3-[3-(2-methoxyethoxycarbonyl)-2,6-dimethyl-5-propan-2-yloxycarbonyl-1,4-dihydropyridin-4-yl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649756) has the molecular formula C31H36N2O9 and a molecular weight of 580.63 g/mol. Its IUPAC name is dimethyl 1-[3-[3-(2-methoxyethoxycarbonyl)-2,6-dimethyl-5-propan-2-yloxycarbonyl-1,4-dihydropyridin-4-yl]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-[3-(2-methoxyethoxycarbonyl)-2,6-dimethyl-5-propan-2-yloxycarbonyl-1,4-dihydropyridin-4-yl]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649756 |
| Molecular Formula | C31H36N2O9 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | dimethyl 1-[3-[3-(2-methoxyethoxycarbonyl)-2,6-dimethyl-5-propan-2-yloxycarbonyl-1,4-dihydropyridin-4-yl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1c1cccc(N2C=CC=CC(C(=O)OC)=C2C(=O)OC)c1 |
| InChI | InChI=1S/C31H36N2O9/c1-18(2)42-30(36)25-20(4)32-19(3)24(29(35)41-16-15-38-5)26(25)21-11-10-12-22(17-21)33-14-9-8-13-23(28(34)39-6)27(33)31(37)40-7/h8-14,17-18,26,32H,15-16H2,1-7H3 |
| InChIKey | ILKLYASUZGGGKX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|