C12H17O — CID 101002355
CID 101002355 (PubChem CID 101002355) has the molecular formula C12H17O and a molecular weight of 177.27 g/mol.
| Compound Name | CID 101002355 |
|---|---|
| PubChem CID | 101002355 |
| Molecular Formula | C12H17O |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | — |
| SMILES | CC1=CC2C(CC1)C1CCC[C@@]21[O] |
| InChI | InChI=1S/C12H17O/c1-8-4-5-9-10-3-2-6-12(10,13)11(9)7-8/h7,9-11H,2-6H2,1H3/t9?,10?,11?,12-/m0/s1 |
| InChIKey | YRCYMKNLZDSYFA-ROAFRPBMSA-N |
| XLogP | 2.94 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|