C12H19N — CID 101003706
5-cyclohexyl-3,3-dimethylpyrrole (PubChem CID 101003706) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 5-cyclohexyl-3,3-dimethylpyrrole.
| Compound Name | 5-cyclohexyl-3,3-dimethylpyrrole |
|---|---|
| PubChem CID | 101003706 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5-cyclohexyl-3,3-dimethylpyrrole |
| SMILES | CC1(C)C=NC(C2CCCCC2)=C1 |
| InChI | InChI=1S/C12H19N/c1-12(2)8-11(13-9-12)10-6-4-3-5-7-10/h8-10H,3-7H2,1-2H3 |
| InChIKey | BEGFNRZRPNHLFW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |