C3H6O4S — CID 101003866
[(4R)-2-oxo-1,3,2-dioxathiolan-4-yl]methanol (PubChem CID 101003866) has the molecular formula C3H6O4S and a molecular weight of 138.14 g/mol. Its IUPAC name is [(4R)-2-oxo-1,3,2-dioxathiolan-4-yl]methanol.
| Compound Name | [(4R)-2-oxo-1,3,2-dioxathiolan-4-yl]methanol |
|---|---|
| PubChem CID | 101003866 |
| Molecular Formula | C3H6O4S |
| Molecular Weight | 138.14 g/mol |
| Exact Mass | 138.00 |
| IUPAC Name | [(4R)-2-oxo-1,3,2-dioxathiolan-4-yl]methanol |
| SMILES | O=S1OC[C@@H](CO)O1 |
| InChI | InChI=1S/C3H6O4S/c4-1-3-2-6-8(5)7-3/h3-4H,1-2H2/t3-,8?/m1/s1 |
| InChIKey | WIPAUXGFNHDOOK-ZIBWXETASA-N |
| XLogP | -1.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.14 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |