C4H7NOS — CID 101003960
(4S)-4-methyl-1,3-oxazolidine-2-thione (PubChem CID 101003960) has the molecular formula C4H7NOS and a molecular weight of 117.17 g/mol. Its IUPAC name is (4S)-4-methyl-1,3-oxazolidine-2-thione.
| Compound Name | (4S)-4-methyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 101003960 |
| Molecular Formula | C4H7NOS |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | (4S)-4-methyl-1,3-oxazolidine-2-thione |
| SMILES | C[C@H]1COC(=S)N1 |
| InChI | InChI=1S/C4H7NOS/c1-3-2-6-4(7)5-3/h3H,2H2,1H3,(H,5,7)/t3-/m0/s1 |
| InChIKey | QNUJAWVJHFZSNW-VKHMYHEASA-N |
| XLogP | 0.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|