C5H9NOS — CID 3006141
4-ethyl-1,3-oxazolidine-2-thione (PubChem CID 3006141) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is 4-ethyl-1,3-oxazolidine-2-thione.
| Compound Name | 4-ethyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 3006141 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 4-ethyl-1,3-oxazolidine-2-thione |
| SMILES | CCC1COC(=S)N1 |
| InChI | InChI=1S/C5H9NOS/c1-2-4-3-7-5(8)6-4/h4H,2-3H2,1H3,(H,6,8) |
| InChIKey | IUQNMFMYZBLMEV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|