C9H14F2O — CID 101004865
(4E)-4,5-difluoronona-1,4-dien-3-ol (PubChem CID 101004865) has the molecular formula C9H14F2O and a molecular weight of 176.21 g/mol. Its IUPAC name is (4E)-4,5-difluoronona-1,4-dien-3-ol.
| Compound Name | (4E)-4,5-difluoronona-1,4-dien-3-ol |
|---|---|
| PubChem CID | 101004865 |
| Molecular Formula | C9H14F2O |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (4E)-4,5-difluoronona-1,4-dien-3-ol |
| SMILES | C=CC(O)/C(F)=C(\F)CCCC |
| InChI | InChI=1S/C9H14F2O/c1-3-5-6-7(10)9(11)8(12)4-2/h4,8,12H,2-3,5-6H2,1H3/b9-7+ |
| InChIKey | MIBLJPNIURYMNH-VQHVLOKHSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|