C26H36NO3PSi — CID 101004978
[(4-methoxyphenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane (PubChem CID 101004978) has the molecular formula C26H36NO3PSi and a molecular weight of 469.64 g/mol. Its IUPAC name is [(4-methoxyphenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane.
| Compound Name | [(4-methoxyphenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 101004978 |
| Molecular Formula | C26H36NO3PSi |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | [(4-methoxyphenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane |
| SMILES | COc1ccc(C(c2nc(-c3ccccc3)oc2O[Si](C)(C)C)P(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C26H36NO3PSi/c1-18(2)31(19(3)4)24(20-14-16-22(28-5)17-15-20)23-26(30-32(6,7)8)29-25(27-23)21-12-10-9-11-13-21/h9-19,24H,1-8H3 |
| InChIKey | NFOVLHYUKFONFR-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|