C25H33FNO2PSi — CID 101004979
[(4-fluorophenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane (PubChem CID 101004979) has the molecular formula C25H33FNO2PSi and a molecular weight of 457.60 g/mol. Its IUPAC name is [(4-fluorophenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane.
| Compound Name | [(4-fluorophenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 101004979 |
| Molecular Formula | C25H33FNO2PSi |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [(4-fluorophenyl)-(2-phenyl-5-trimethylsilyloxy-1,3-oxazol-4-yl)methyl]-di(propan-2-yl)phosphane |
| SMILES | CC(C)P(C(C)C)C(c1ccc(F)cc1)c1nc(-c2ccccc2)oc1O[Si](C)(C)C |
| InChI | InChI=1S/C25H33FNO2PSi/c1-17(2)30(18(3)4)23(19-13-15-21(26)16-14-19)22-25(29-31(5,6)7)28-24(27-22)20-11-9-8-10-12-20/h8-18,23H,1-7H3 |
| InChIKey | IBQMJFCJYRLVLJ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|