C56H48N4O4 — CID 101005398
26,28-bis[[4-[(4-methylphenyl)diazenyl]phenyl]methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol (PubChem CID 101005398) has the molecular formula C56H48N4O4 and a molecular weight of 841.02 g/mol. Its IUPAC name is 26,28-bis[[4-[(4-methylphenyl)diazenyl]phenyl]methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol.
| Compound Name | 26,28-bis[[4-[(4-methylphenyl)diazenyl]phenyl]methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 101005398 |
| Molecular Formula | C56H48N4O4 |
| Molecular Weight | 841.02 g/mol |
| Exact Mass | 840.37 |
| IUPAC Name | 26,28-bis[[4-[(4-methylphenyl)diazenyl]phenyl]methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol |
| SMILES | Cc1ccc(/N=N/c2ccc(COc3c4cccc3Cc3cccc(c3O)Cc3cccc(c3OCc3ccc(/N=N/c5ccc(C)cc5)cc3)Cc3cccc(c3O)C4)cc2)cc1 |
| InChI | InChI=1S/C56H48N4O4/c1-37-15-23-49(24-16-37)57-59-51-27-19-39(20-28-51)35-63-55-45-11-5-12-46(55)32-42-8-4-10-44(54(42)62)34-48-14-6-13-47(33-43-9-3-7-41(31-45)53(43)61)56(48)64-36-40-21-29-52(30-22-40)60-58-50-25-17-38(2)18-26-50/h3-30,61-62H,31-36H2,1-2H3/b59-57+,60-58+ |
| InChIKey | IMXAOBUOFVKHPJ-YGZNCWGHSA-N |
| XLogP | 14.38 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.02 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|