C19H37NO3 — CID 101005763
(2S,3S)-3-(1-hydroxytetradecyl)-N,N-dimethyloxirane-2-carboxamide (PubChem CID 101005763) has the molecular formula C19H37NO3 and a molecular weight of 327.51 g/mol. Its IUPAC name is (2S,3S)-3-(1-hydroxytetradecyl)-N,N-dimethyloxirane-2-carboxamide.
| Compound Name | (2S,3S)-3-(1-hydroxytetradecyl)-N,N-dimethyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 101005763 |
| Molecular Formula | C19H37NO3 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | (2S,3S)-3-(1-hydroxytetradecyl)-N,N-dimethyloxirane-2-carboxamide |
| SMILES | CCCCCCCCCCCCCC(O)[C@@H]1O[C@@H]1C(=O)N(C)C |
| InChI | InChI=1S/C19H37NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(21)17-18(23-17)19(22)20(2)3/h16-18,21H,4-15H2,1-3H3/t16?,17-,18-/m0/s1 |
| InChIKey | PGHGYMDTVFATPV-FQECFTEESA-N |
| XLogP | 3.90 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|