C37H40F3N3O5 — CID 10100911
(1R,5S)-3-acetyl-N-cyclopropyl-N-[(3,4-dimethoxyphenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 10100911) has the molecular formula C37H40F3N3O5 and a molecular weight of 663.74 g/mol. Its IUPAC name is (1R,5S)-3-acetyl-N-cyclopropyl-N-[(3,4-dimethoxyphenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | (1R,5S)-3-acetyl-N-cyclopropyl-N-[(3,4-dimethoxyphenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 10100911 |
| Molecular Formula | C37H40F3N3O5 |
| Molecular Weight | 663.74 g/mol |
| Exact Mass | 663.29 |
| IUPAC Name | (1R,5S)-3-acetyl-N-cyclopropyl-N-[(3,4-dimethoxyphenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | COc1ccc(CN(C(=O)C2=C(c3ccc(CCCOc4c(F)ccc(F)c4F)cc3)C[C@@H]3CN(C(C)=O)C[C@H]2N3)C2CC2)cc1OC |
| InChI | InChI=1S/C37H40F3N3O5/c1-22(44)42-20-26-18-28(25-9-6-23(7-10-25)5-4-16-48-36-30(39)14-13-29(38)35(36)40)34(31(21-42)41-26)37(45)43(27-11-12-27)19-24-8-15-32(46-2)33(17-24)47-3/h6-10,13-15,17,26-27,31,41H,4-5,11-12,16,18-21H2,1-3H3/t26-,31-/m1/s1 |
| InChIKey | VACFNXHZZNJTBM-MXBOTTGLSA-N |
| XLogP | 5.67 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|