C14H15N3O3S — CID 101009410
S-morpholin-4-yl N-(1H-indole-3-carbonyl)carbamothioate (PubChem CID 101009410) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is S-morpholin-4-yl N-(1H-indole-3-carbonyl)carbamothioate.
| Compound Name | S-morpholin-4-yl N-(1H-indole-3-carbonyl)carbamothioate |
|---|---|
| PubChem CID | 101009410 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | S-morpholin-4-yl N-(1H-indole-3-carbonyl)carbamothioate |
| SMILES | O=C(NC(=O)c1c[nH]c2ccccc12)SN1CCOCC1 |
| InChI | InChI=1S/C14H15N3O3S/c18-13(11-9-15-12-4-2-1-3-10(11)12)16-14(19)21-17-5-7-20-8-6-17/h1-4,9,15H,5-8H2,(H,16,18,19) |
| InChIKey | YGEGGFNOZQUXFQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|