C21H27N3O3 — CID 101011542
2-[[3,5-bis(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole (PubChem CID 101011542) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[[3,5-bis(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[[3,5-bis(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 101011542 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[[3,5-bis(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1c(CC2=NCCO2)c(C)c(CC2=NCCO2)c(C)c1CC1=NCCO1 |
| InChI | InChI=1S/C21H27N3O3/c1-13-16(10-19-22-4-7-25-19)14(2)18(12-21-24-6-9-27-21)15(3)17(13)11-20-23-5-8-26-20/h4-12H2,1-3H3 |
| InChIKey | ZRERLCIVGNQZKK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |