C27H39N3O3 — CID 11166913
2-[[3,5-bis[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-2,4,6-trimethylphenyl]methyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 11166913) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-[[3,5-bis[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-2,4,6-trimethylphenyl]methyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[[3,5-bis[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-2,4,6-trimethylphenyl]methyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 11166913 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | 2-[[3,5-bis[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-2,4,6-trimethylphenyl]methyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | Cc1c(CC2=NC(C)(C)CO2)c(C)c(CC2=NC(C)(C)CO2)c(C)c1CC1=NC(C)(C)CO1 |
| InChI | InChI=1S/C27H39N3O3/c1-16-19(10-22-28-25(4,5)13-31-22)17(2)21(12-24-30-27(8,9)15-33-24)18(3)20(16)11-23-29-26(6,7)14-32-23/h10-15H2,1-9H3 |
| InChIKey | JLFRRWJYUCZUFJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |