C13H21N — CID 101011722
1-(3-cyclopenta-2,4-dien-1-ylpropyl)piperidine (PubChem CID 101011722) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-(3-cyclopenta-2,4-dien-1-ylpropyl)piperidine.
| Compound Name | 1-(3-cyclopenta-2,4-dien-1-ylpropyl)piperidine |
|---|---|
| PubChem CID | 101011722 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1-(3-cyclopenta-2,4-dien-1-ylpropyl)piperidine |
| SMILES | C1=CC(CCCN2CCCCC2)C=C1 |
| InChI | InChI=1S/C13H21N/c1-4-10-14(11-5-1)12-6-9-13-7-2-3-8-13/h2-3,7-8,13H,1,4-6,9-12H2 |
| InChIKey | NWBXTOILDQOJPF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |