C13H22N2 — CID 138454485
1-(4-cyclopenta-2,4-dien-1-ylbutyl)piperazine (PubChem CID 138454485) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(4-cyclopenta-2,4-dien-1-ylbutyl)piperazine.
| Compound Name | 1-(4-cyclopenta-2,4-dien-1-ylbutyl)piperazine |
|---|---|
| PubChem CID | 138454485 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(4-cyclopenta-2,4-dien-1-ylbutyl)piperazine |
| SMILES | C1=CC(CCCCN2CCNCC2)C=C1 |
| InChI | InChI=1S/C13H22N2/c1-2-6-13(5-1)7-3-4-10-15-11-8-14-9-12-15/h1-2,5-6,13-14H,3-4,7-12H2 |
| InChIKey | QYSYGEDOIJKDDE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|