C26H44Si4 — CID 101013161
[2-[(E)-2-[2,5-bis(trimethylsilyl)phenyl]ethenyl]-4-trimethylsilylphenyl]-trimethylsilane (PubChem CID 101013161) has the molecular formula C26H44Si4 and a molecular weight of 468.98 g/mol. Its IUPAC name is [2-[(E)-2-[2,5-bis(trimethylsilyl)phenyl]ethenyl]-4-trimethylsilylphenyl]-trimethylsilane.
| Compound Name | [2-[(E)-2-[2,5-bis(trimethylsilyl)phenyl]ethenyl]-4-trimethylsilylphenyl]-trimethylsilane |
|---|---|
| PubChem CID | 101013161 |
| Molecular Formula | C26H44Si4 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [2-[(E)-2-[2,5-bis(trimethylsilyl)phenyl]ethenyl]-4-trimethylsilylphenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc([Si](C)(C)C)c(/C=C/c2cc([Si](C)(C)C)ccc2[Si](C)(C)C)c1 |
| InChI | InChI=1S/C26H44Si4/c1-27(2,3)23-15-17-25(29(7,8)9)21(19-23)13-14-22-20-24(28(4,5)6)16-18-26(22)30(10,11)12/h13-20H,1-12H3/b14-13+ |
| InChIKey | QOMYDVKCAUPTFI-BUHFOSPRSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|