C13H12F6O2S — CID 101016077
(Z,2R,6S)-1,1,1,7,7,7-hexafluoro-4-phenylsulfanylhept-3-ene-2,6-diol (PubChem CID 101016077) has the molecular formula C13H12F6O2S and a molecular weight of 346.29 g/mol. Its IUPAC name is (Z,2R,6S)-1,1,1,7,7,7-hexafluoro-4-phenylsulfanylhept-3-ene-2,6-diol.
| Compound Name | (Z,2R,6S)-1,1,1,7,7,7-hexafluoro-4-phenylsulfanylhept-3-ene-2,6-diol |
|---|---|
| PubChem CID | 101016077 |
| Molecular Formula | C13H12F6O2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (Z,2R,6S)-1,1,1,7,7,7-hexafluoro-4-phenylsulfanylhept-3-ene-2,6-diol |
| SMILES | O[C@H](/C=C(/C[C@H](O)C(F)(F)F)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H12F6O2S/c14-12(15,16)10(20)6-9(7-11(21)13(17,18)19)22-8-4-2-1-3-5-8/h1-6,10-11,20-21H,7H2/b9-6-/t10-,11+/m1/s1 |
| InChIKey | HLKTUEBNXFDNKP-KJNJGPFHSA-N |
| XLogP | 3.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |