C42H78NO10P — CID 10101803
[6-hydroxy-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]oxan-3-yl] bis(prop-2-enyl) phosphate (PubChem CID 10101803) has the molecular formula C42H78NO10P and a molecular weight of 788.06 g/mol. Its IUPAC name is [6-hydroxy-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]oxan-3-yl] bis(prop-2-enyl) phosphate.
| Compound Name | [6-hydroxy-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]oxan-3-yl] bis(prop-2-enyl) phosphate |
|---|---|
| PubChem CID | 10101803 |
| Molecular Formula | C42H78NO10P |
| Molecular Weight | 788.06 g/mol |
| Exact Mass | 787.54 |
| IUPAC Name | [6-hydroxy-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]oxan-3-yl] bis(prop-2-enyl) phosphate |
| SMILES | C=CCOP(=O)(OCC=C)OC1C(COC)OC(O)C(NC(=O)CCCCCCCCC/C=C\CCCCCC)C1OCC[C@@H](CCCCCCC)OC |
| InChI | InChI=1S/C42H78NO10P/c1-7-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-38(44)43-39-41(49-34-31-36(48-6)29-27-25-14-12-8-2)40(37(35-47-5)52-42(39)45)53-54(46,50-32-9-3)51-33-10-4/h9-10,17-18,36-37,39-42,45H,3-4,7-8,11-16,19-35H2,1-2,5-6H3,(H,43,44)/b18-17-/t36-,37?,39?,40?,41?,42?/m1/s1 |
| InChIKey | VAGKLXQESDOZTI-UMMJHKDUSA-N |
| XLogP | 9.92 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.06 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|