C45H82NO10P — CID 58675448
[(2R,3S,4R,5R)-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]-6-[(Z)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate (PubChem CID 58675448) has the molecular formula C45H82NO10P and a molecular weight of 828.12 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]-6-[(Z)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate.
| Compound Name | [(2R,3S,4R,5R)-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]-6-[(Z)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate |
|---|---|
| PubChem CID | 58675448 |
| Molecular Formula | C45H82NO10P |
| Molecular Weight | 828.12 g/mol |
| Exact Mass | 827.57 |
| IUPAC Name | [(2R,3S,4R,5R)-4-[(3R)-3-methoxydecoxy]-2-(methoxymethyl)-5-[[(Z)-octadec-11-enoyl]amino]-6-[(Z)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate |
| SMILES | C=CCOP(=O)(OCC=C)O[C@H]1[C@H](OCC[C@@H](CCCCCCC)OC)[C@@H](NC(=O)CCCCCCCCC/C=C\CCCCCC)C(O/C=C\C)O[C@@H]1COC |
| InChI | InChI=1S/C45H82NO10P/c1-8-13-15-17-18-19-20-21-22-23-24-25-26-28-30-32-41(47)46-42-44(51-37-33-39(50-7)31-29-27-16-14-9-2)43(40(38-49-6)55-45(42)52-34-10-3)56-57(48,53-35-11-4)54-36-12-5/h10-12,19-20,34,39-40,42-45H,4-5,8-9,13-18,21-33,35-38H2,1-3,6-7H3,(H,46,47)/b20-19-,34-10-/t39-,40-,42-,43-,44-,45?/m1/s1 |
| InChIKey | KRLBSJZSLTYRDB-ASXCSCRISA-N |
| XLogP | 11.48 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.12 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|