C32H61NO7 — CID 71080226
N-[(2S,3R,5S)-5-hydroxy-4-(3-methoxydecoxy)-6-(methoxymethyl)-2-[(Z)-prop-1-enoxy]oxan-3-yl]undecanamide (PubChem CID 71080226) has the molecular formula C32H61NO7 and a molecular weight of 571.84 g/mol. Its IUPAC name is N-[(2S,3R,5S)-5-hydroxy-4-(3-methoxydecoxy)-6-(methoxymethyl)-2-[(Z)-prop-1-enoxy]oxan-3-yl]undecanamide.
| Compound Name | N-[(2S,3R,5S)-5-hydroxy-4-(3-methoxydecoxy)-6-(methoxymethyl)-2-[(Z)-prop-1-enoxy]oxan-3-yl]undecanamide |
|---|---|
| PubChem CID | 71080226 |
| Molecular Formula | C32H61NO7 |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 571.44 |
| IUPAC Name | N-[(2S,3R,5S)-5-hydroxy-4-(3-methoxydecoxy)-6-(methoxymethyl)-2-[(Z)-prop-1-enoxy]oxan-3-yl]undecanamide |
| SMILES | C/C=C\O[C@H]1OC(COC)[C@@H](O)C(OCCC(CCCCCCC)OC)[C@H]1NC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C32H61NO7/c1-6-9-11-13-14-15-17-19-21-28(34)33-29-31(30(35)27(25-36-4)40-32(29)39-23-8-3)38-24-22-26(37-5)20-18-16-12-10-7-2/h8,23,26-27,29-32,35H,6-7,9-22,24-25H2,1-5H3,(H,33,34)/b23-8-/t26?,27?,29-,30-,31?,32+/m1/s1 |
| InChIKey | ISEHCXBVAJLFQP-KTYKMBCJSA-N |
| XLogP | 6.44 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|