C38H70O8 — CID 86628380
[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-[(E)-prop-1-enoxy]oxan-3-yl] (Z)-octadec-11-enoate (PubChem CID 86628380) has the molecular formula C38H70O8 and a molecular weight of 654.97 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-[(E)-prop-1-enoxy]oxan-3-yl] (Z)-octadec-11-enoate.
| Compound Name | [(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-[(E)-prop-1-enoxy]oxan-3-yl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 86628380 |
| Molecular Formula | C38H70O8 |
| Molecular Weight | 654.97 g/mol |
| Exact Mass | 654.51 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-[(E)-prop-1-enoxy]oxan-3-yl] (Z)-octadec-11-enoate |
| SMILES | C/C=C/O[C@H]1O[C@H](CO)[C@@H](O)[C@H](OCC[C@@H](CCCCCCC)OC)[C@H]1OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C38H70O8/c1-5-8-10-12-13-14-15-16-17-18-19-20-21-23-25-27-34(40)46-37-36(35(41)33(31-39)45-38(37)44-29-7-3)43-30-28-32(42-4)26-24-22-11-9-6-2/h7,14-15,29,32-33,35-39,41H,5-6,8-13,16-28,30-31H2,1-4H3/b15-14-,29-7+/t32-,33-,35-,36+,37-,38+/m1/s1 |
| InChIKey | MMWCBGUXXAZWOX-XDSYLOFWSA-N |
| XLogP | 8.71 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.97 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|