C41H80O8Si — CID 68953152
[(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]oxan-3-yl] (Z)-octadec-11-enoate (PubChem CID 68953152) has the molecular formula C41H80O8Si and a molecular weight of 729.17 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]oxan-3-yl] (Z)-octadec-11-enoate.
| Compound Name | [(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]oxan-3-yl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 68953152 |
| Molecular Formula | C41H80O8Si |
| Molecular Weight | 729.17 g/mol |
| Exact Mass | 728.56 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]oxan-3-yl] (Z)-octadec-11-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)O[C@@H]1[C@@H](OCC[C@@H](CCCCCCC)OC)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1O |
| InChI | InChI=1S/C41H80O8Si/c1-9-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-36(42)49-39-38(46-32-31-34(45-6)29-27-25-14-12-10-2)37(43)35(48-40(39)44)33-47-50(7,8)41(3,4)5/h17-18,34-35,37-40,43-44H,9-16,19-33H2,1-8H3/b18-17-/t34-,35-,37-,38+,39-,40+/m1/s1 |
| InChIKey | QACVCHKYAUODAP-BKTPLVLJSA-N |
| XLogP | 10.19 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.17 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|