C39H70O10 — CID 68954363
[(3R,4S,5R,6R)-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] (Z)-octadec-11-enoate (PubChem CID 68954363) has the molecular formula C39H70O10 and a molecular weight of 698.98 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] (Z)-octadec-11-enoate.
| Compound Name | [(3R,4S,5R,6R)-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 68954363 |
| Molecular Formula | C39H70O10 |
| Molecular Weight | 698.98 g/mol |
| Exact Mass | 698.50 |
| IUPAC Name | [(3R,4S,5R,6R)-2,5-dihydroxy-4-[(3R)-3-methoxydecoxy]-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] (Z)-octadec-11-enoate |
| SMILES | C=CCOC(=O)OC[C@H]1OC(O)[C@H](OC(=O)CCCCCCCCC/C=C\CCCCCC)[C@@H](OCC[C@@H](CCCCCCC)OC)[C@@H]1O |
| InChI | InChI=1S/C39H70O10/c1-5-8-10-12-13-14-15-16-17-18-19-20-21-23-25-27-34(40)49-37-36(45-30-28-32(44-4)26-24-22-11-9-6-2)35(41)33(48-38(37)42)31-47-39(43)46-29-7-3/h7,14-15,32-33,35-38,41-42H,3,5-6,8-13,16-31H2,1-2,4H3/b15-14-/t32-,33-,35-,36+,37-,38?/m1/s1 |
| InChIKey | CHZVIPDXJKANKN-RUEOHOIFSA-N |
| XLogP | 8.50 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.98 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|