C27H44Cl3NO10 — CID 139901853
[(2R,3S,4R,5R,6S)-3-hydroxy-4-[(3R)-3-methoxydecoxy]-6-prop-1-enoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl prop-2-enyl carbonate (PubChem CID 139901853) has the molecular formula C27H44Cl3NO10 and a molecular weight of 649.00 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3-hydroxy-4-[(3R)-3-methoxydecoxy]-6-prop-1-enoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl prop-2-enyl carbonate.
| Compound Name | [(2R,3S,4R,5R,6S)-3-hydroxy-4-[(3R)-3-methoxydecoxy]-6-prop-1-enoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl prop-2-enyl carbonate |
|---|---|
| PubChem CID | 139901853 |
| Molecular Formula | C27H44Cl3NO10 |
| Molecular Weight | 649.00 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3-hydroxy-4-[(3R)-3-methoxydecoxy]-6-prop-1-enoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC[C@H]1O[C@H](OC=CC)[C@H](NC(=O)OCC(Cl)(Cl)Cl)[C@@H](OCC[C@@H](CCCCCCC)OC)[C@@H]1O |
| InChI | InChI=1S/C27H44Cl3NO10/c1-5-8-9-10-11-12-19(35-4)13-16-36-23-21(31-25(33)40-18-27(28,29)30)24(37-14-6-2)41-20(22(23)32)17-39-26(34)38-15-7-3/h6-7,14,19-24,32H,3,5,8-13,15-18H2,1-2,4H3,(H,31,33)/t19-,20-,21-,22-,23-,24+/m1/s1 |
| InChIKey | RAXJPXKHUMFVCI-QALHXSLCSA-N |
| XLogP | 5.58 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.00 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|