C22H38F3NO7 — CID 59080406
2,2,2-trifluoro-N-[(2S,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-prop-2-enoxyoxan-3-yl]acetamide (PubChem CID 59080406) has the molecular formula C22H38F3NO7 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-prop-2-enoxyoxan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-prop-2-enoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 59080406 |
| Molecular Formula | C22H38F3NO7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-methoxydecoxy]-2-prop-2-enoxyoxan-3-yl]acetamide |
| SMILES | C=CCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OCC[C@@H](CCCCCCC)OC)C1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H38F3NO7/c1-4-6-7-8-9-10-15(30-3)11-13-31-19-17(26-21(29)22(23,24)25)20(32-12-5-2)33-16(14-27)18(19)28/h5,15-20,27-28H,2,4,6-14H2,1,3H3,(H,26,29)/t15-,16-,17?,18-,19-,20+/m1/s1 |
| InChIKey | JBEPMFRUJWRRFK-OJTLSIKESA-N |
| XLogP | 2.46 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|