C30H46Cl3NO9 — CID 139983493
2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-[(4-methoxyphenyl)methoxy]decoxy]-2-prop-2-enoxyoxan-3-yl]carbamate (PubChem CID 139983493) has the molecular formula C30H46Cl3NO9 and a molecular weight of 671.06 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-[(4-methoxyphenyl)methoxy]decoxy]-2-prop-2-enoxyoxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-[(4-methoxyphenyl)methoxy]decoxy]-2-prop-2-enoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 139983493 |
| Molecular Formula | C30H46Cl3NO9 |
| Molecular Weight | 671.06 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(3R)-3-[(4-methoxyphenyl)methoxy]decoxy]-2-prop-2-enoxyoxan-3-yl]carbamate |
| SMILES | C=CCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OCC[C@@H](CCCCCCC)OCc2ccc(OC)cc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H46Cl3NO9/c1-4-6-7-8-9-10-23(41-19-21-11-13-22(38-3)14-12-21)15-17-39-27-25(34-29(37)42-20-30(31,32)33)28(40-16-5-2)43-24(18-35)26(27)36/h5,11-14,23-28,35-36H,2,4,6-10,15-20H2,1,3H3,(H,34,37)/t23-,24-,25-,26-,27-,28+/m1/s1 |
| InChIKey | QSUILFRSNVHXMU-PYFBZWTESA-N |
| XLogP | 5.46 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.06 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|