C20H40O5 — CID 58675427
4-(3-methoxydecoxy)-2-(methoxymethyl)-5,6-dimethyloxan-3-ol (PubChem CID 58675427) has the molecular formula C20H40O5 and a molecular weight of 360.54 g/mol. Its IUPAC name is 4-(3-methoxydecoxy)-2-(methoxymethyl)-5,6-dimethyloxan-3-ol.
| Compound Name | 4-(3-methoxydecoxy)-2-(methoxymethyl)-5,6-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 58675427 |
| Molecular Formula | C20H40O5 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | 4-(3-methoxydecoxy)-2-(methoxymethyl)-5,6-dimethyloxan-3-ol |
| SMILES | CCCCCCCC(CCOC1C(C)C(C)OC(COC)C1O)OC |
| InChI | InChI=1S/C20H40O5/c1-6-7-8-9-10-11-17(23-5)12-13-24-20-15(2)16(3)25-18(14-22-4)19(20)21/h15-21H,6-14H2,1-5H3 |
| InChIKey | CVIIJHZUZDHHKS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|