About ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate
ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 101018353) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate.
Analyze ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate?
The IUPAC name of ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate (CID 101018353) is ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate.
What is the SMILES notation for ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate?
The canonical SMILES for ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate is CCOC(=O)C1=C[C@H](OCC)C[C@H](OCC)O1.
What is the InChIKey of ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate?
The InChIKey is SXQLANAZDLEWNM-GXSJLCMTSA-N. The full InChI is InChI=1S/C12H20O5/c1-4-14-9-7-10(12(13)16-6-3)17-11(8-9)15-5-2/h7,9,11H,4-6,8H2,1-3H3/t9-,11+/m0/s1.
What are the key properties of ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate?
ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate has a molecular weight of 244.29 g/mol, XLogP of 1.62, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R,4R)-2,4-diethoxy-3,4-dihydro-2H-pyran-6-carboxylate is sourced from PubChem (CID 101018353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).