methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate

C11H18O7 — CID 14092370

IUPACmethyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate
SMILESCOC(=O)C1=CC(OC)C(OC)C(OC)(OC)O1
InChIInChI=1S/C11H18O7/c1-13-7-6-8(10(12)15-3)18-11(16-4,17-5)9(7)14-2/h6-7,9H,1-5H3
InChIKeyKSFLTMKOSQUTOC-UHFFFAOYSA-N
MW262.26 g/mol
LogP0.05
Rot. Bonds5

About methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate

methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate (PubChem CID 14092370) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate.

Molecular Properties

Compound Namemethyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate
PubChem CID14092370
Molecular FormulaC11H18O7
Molecular Weight262.26 g/mol
Exact Mass262.11
IUPAC Namemethyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate
SMILESCOC(=O)C1=CC(OC)C(OC)C(OC)(OC)O1
InChIInChI=1S/C11H18O7/c1-13-7-6-8(10(12)15-3)18-11(16-4,17-5)9(7)14-2/h6-7,9H,1-5H3
InChIKeyKSFLTMKOSQUTOC-UHFFFAOYSA-N
XLogP0.05
TPSA72.45 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 50.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate?
The IUPAC name of methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate (CID 14092370) is methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate.
What is the SMILES notation for methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate?
The canonical SMILES for methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate is COC(=O)C1=CC(OC)C(OC)C(OC)(OC)O1.
What is the InChIKey of methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate?
The InChIKey is KSFLTMKOSQUTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O7/c1-13-7-6-8(10(12)15-3)18-11(16-4,17-5)9(7)14-2/h6-7,9H,1-5H3.
What are the key properties of methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate?
methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate has a molecular weight of 262.26 g/mol, XLogP of 0.05, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate is sourced from PubChem (CID 14092370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).