C11H18O7 — CID 14092370
methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate (PubChem CID 14092370) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate.
| Compound Name | methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 14092370 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | methyl 2,2,3,4-tetramethoxy-3,4-dihydropyran-6-carboxylate |
| SMILES | COC(=O)C1=CC(OC)C(OC)C(OC)(OC)O1 |
| InChI | InChI=1S/C11H18O7/c1-13-7-6-8(10(12)15-3)18-11(16-4,17-5)9(7)14-2/h6-7,9H,1-5H3 |
| InChIKey | KSFLTMKOSQUTOC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|