C10H18O4 — CID 101018358
methyl (3S)-3-[(2R,3S)-2-methoxyoxolan-3-yl]butanoate (PubChem CID 101018358) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl (3S)-3-[(2R,3S)-2-methoxyoxolan-3-yl]butanoate.
| Compound Name | methyl (3S)-3-[(2R,3S)-2-methoxyoxolan-3-yl]butanoate |
|---|---|
| PubChem CID | 101018358 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | methyl (3S)-3-[(2R,3S)-2-methoxyoxolan-3-yl]butanoate |
| SMILES | COC(=O)C[C@H](C)[C@@H]1CCO[C@H]1OC |
| InChI | InChI=1S/C10H18O4/c1-7(6-9(11)12-2)8-4-5-14-10(8)13-3/h7-8,10H,4-6H2,1-3H3/t7-,8-,10+/m0/s1 |
| InChIKey | NYYNKDUEQHHISS-OYNCUSHFSA-N |
| XLogP | 1.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |