C15H21NO6 — CID 101018394
(2Z)-2-[(3aR,6S,7S,7aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-ylidene]acetonitrile (PubChem CID 101018394) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is (2Z)-2-[(3aR,6S,7S,7aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-ylidene]acetonitrile.
| Compound Name | (2Z)-2-[(3aR,6S,7S,7aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 101018394 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (2Z)-2-[(3aR,6S,7S,7aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-ylidene]acetonitrile |
| SMILES | CC1(C)OC[C@H]([C@H]2O/C(=C\C#N)[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O)O1 |
| InChI | InChI=1S/C15H21NO6/c1-14(2)18-7-9(20-14)11-10(17)13-12(8(19-11)5-6-16)21-15(3,4)22-13/h5,9-13,17H,7H2,1-4H3/b8-5-/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | ALJWQVZTZITWRP-GSHVWORGSA-N |
| XLogP | 0.83 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|