C15H24O5 — CID 102387285
(1R,2S,6S,7Z,9R)-4,4,12,12-tetramethyl-7-propylidene-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 102387285) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1R,2S,6S,7Z,9R)-4,4,12,12-tetramethyl-7-propylidene-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2S,6S,7Z,9R)-4,4,12,12-tetramethyl-7-propylidene-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 102387285 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1R,2S,6S,7Z,9R)-4,4,12,12-tetramethyl-7-propylidene-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC/C=C1\O[C@@H]2COC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H24O5/c1-6-7-9-11-13(20-15(4,5)19-11)12-10(17-9)8-16-14(2,3)18-12/h7,10-13H,6,8H2,1-5H3/b9-7-/t10-,11-,12-,13-/m1/s1 |
| InChIKey | QOQBCXALHOAIMT-UBXHCTEUSA-N |
| XLogP | 2.35 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |