C22H30O3 — CID 101023775
5-[(1E,3Z,6Z,9Z,12Z)-14-(3-ethyloxiran-2-yl)tetradeca-1,3,6,9,12-pentaenyl]oxolan-2-one (PubChem CID 101023775) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 5-[(1E,3Z,6Z,9Z,12Z)-14-(3-ethyloxiran-2-yl)tetradeca-1,3,6,9,12-pentaenyl]oxolan-2-one.
| Compound Name | 5-[(1E,3Z,6Z,9Z,12Z)-14-(3-ethyloxiran-2-yl)tetradeca-1,3,6,9,12-pentaenyl]oxolan-2-one |
|---|---|
| PubChem CID | 101023775 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 5-[(1E,3Z,6Z,9Z,12Z)-14-(3-ethyloxiran-2-yl)tetradeca-1,3,6,9,12-pentaenyl]oxolan-2-one |
| SMILES | CCC1OC1C/C=C\C/C=C\C/C=C\C/C=C\C=C\C1CCC(=O)O1 |
| InChI | InChI=1S/C22H30O3/c1-2-20-21(25-20)16-14-12-10-8-6-4-3-5-7-9-11-13-15-19-17-18-22(23)24-19/h3,5-6,8-9,11-15,19-21H,2,4,7,10,16-18H2,1H3/b5-3-,8-6-,11-9-,14-12-,15-13+ |
| InChIKey | UUHZGVHAFULSFN-XOIYLZSFSA-N |
| XLogP | 5.21 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|