C15H22NO3+ — CID 101024095
methyl (2R)-2-(4-methoxyphenyl)-2-[(2R)-piperidin-1-ium-2-yl]acetate (PubChem CID 101024095) has the molecular formula C15H22NO3+ and a molecular weight of 264.34 g/mol. Its IUPAC name is methyl (2R)-2-(4-methoxyphenyl)-2-[(2R)-piperidin-1-ium-2-yl]acetate.
| Compound Name | methyl (2R)-2-(4-methoxyphenyl)-2-[(2R)-piperidin-1-ium-2-yl]acetate |
|---|---|
| PubChem CID | 101024095 |
| Molecular Formula | C15H22NO3+ |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | methyl (2R)-2-(4-methoxyphenyl)-2-[(2R)-piperidin-1-ium-2-yl]acetate |
| SMILES | COC(=O)[C@H](c1ccc(OC)cc1)[C@H]1CCCC[NH2+]1 |
| InChI | InChI=1S/C15H21NO3/c1-18-12-8-6-11(7-9-12)14(15(17)19-2)13-5-3-4-10-16-13/h6-9,13-14,16H,3-5,10H2,1-2H3/p+1/t13-,14-/m1/s1 |
| InChIKey | FCAMCDYOMMHOJE-ZIAGYGMSSA-O |
| XLogP | 1.07 |
| TPSA | 52.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |