C18H23Cl3O3 — CID 132507385
2,2,2-trichloroethyl 2-cycloheptyl-2-(4-methoxyphenyl)acetate (PubChem CID 132507385) has the molecular formula C18H23Cl3O3 and a molecular weight of 393.74 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-cycloheptyl-2-(4-methoxyphenyl)acetate.
| Compound Name | 2,2,2-trichloroethyl 2-cycloheptyl-2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 132507385 |
| Molecular Formula | C18H23Cl3O3 |
| Molecular Weight | 393.74 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2,2,2-trichloroethyl 2-cycloheptyl-2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(C(C(=O)OCC(Cl)(Cl)Cl)C2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H23Cl3O3/c1-23-15-10-8-14(9-11-15)16(13-6-4-2-3-5-7-13)17(22)24-12-18(19,20)21/h8-11,13,16H,2-7,12H2,1H3 |
| InChIKey | RXOCIHQUNFYEMW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|