C19H23N3O6 — CID 101025644
1-O-tert-butyl 3-O-ethyl 5-(2-methoxycarbonylanilino)pyrazole-1,3-dicarboxylate (PubChem CID 101025644) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 5-(2-methoxycarbonylanilino)pyrazole-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 5-(2-methoxycarbonylanilino)pyrazole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101025644 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 5-(2-methoxycarbonylanilino)pyrazole-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(Nc2ccccc2C(=O)OC)n(C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C19H23N3O6/c1-6-27-17(24)14-11-15(22(21-14)18(25)28-19(2,3)4)20-13-10-8-7-9-12(13)16(23)26-5/h7-11,20H,6H2,1-5H3 |
| InChIKey | WDTLVYVQEIZGAL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|