C14H16N2O11 — CID 101026195
3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-nitro-2-oxo-1-pyridinyl)oxan-2-yl]methoxy]propanoic acid (PubChem CID 101026195) has the molecular formula C14H16N2O11 and a molecular weight of 388.29 g/mol. Its IUPAC name is 3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-nitro-2-oxo-1-pyridinyl)oxan-2-yl]methoxy]propanoic acid.
| Compound Name | 3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-nitro-2-oxo-1-pyridinyl)oxan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 101026195 |
| Molecular Formula | C14H16N2O11 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(5-nitro-2-oxo-1-pyridinyl)oxan-2-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CC(=O)OC[C@H]1O[C@@H](n2cc([N+](=O)[O-])ccc2=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16N2O11/c17-8-2-1-6(16(24)25)4-15(8)14-13(23)12(22)11(21)7(27-14)5-26-10(20)3-9(18)19/h1-2,4,7,11-14,21-23H,3,5H2,(H,18,19)/t7-,11-,12+,13-,14-/m1/s1 |
| InChIKey | FDWJBMZAPYJIPI-FXXKZNHDSA-N |
| XLogP | -2.25 |
| TPSA | 198.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|