C25H34O5 — CID 101027136
CID 101027136 (PubChem CID 101027136) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol.
| Compound Name | CID 101027136 |
|---|---|
| PubChem CID | 101027136 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | — |
| SMILES | CCC1(O)CC(=O)O[C@@]12CC[C@H]1[C@@H]3CC=C4CC5(CC[C@@H]4C3=CC[C@@]12C)OCCO5 |
| InChI | InChI=1S/C25H34O5/c1-3-23(27)15-21(26)30-25(23)11-8-20-19-5-4-16-14-24(28-12-13-29-24)10-7-17(16)18(19)6-9-22(20,25)2/h4,6,17,19-20,27H,3,5,7-15H2,1-2H3/t17-,19+,20-,22-,23?,25+/m0/s1 |
| InChIKey | CUNQXGKNMKHVJW-BMMXMRFWSA-N |
| XLogP | 4.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|