C23H29ClO2 — CID 18610792
(8S,10S,13S,14S,17S)-2-(2-chloroethynyl)-17-ethyl-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 18610792) has the molecular formula C23H29ClO2 and a molecular weight of 372.94 g/mol. Its IUPAC name is (8S,10S,13S,14S,17S)-2-(2-chloroethynyl)-17-ethyl-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17S)-2-(2-chloroethynyl)-17-ethyl-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 18610792 |
| Molecular Formula | C23H29ClO2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (8S,10S,13S,14S,17S)-2-(2-chloroethynyl)-17-ethyl-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C(C#CCl)C[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C23H29ClO2/c1-4-23(26)11-8-19-17-6-5-16-13-20(25)15(9-12-24)14-21(16,2)18(17)7-10-22(19,23)3/h7,13,15,17,19,26H,4-6,8,10-11,14H2,1-3H3/t15?,17-,19+,21+,22+,23+/m1/s1 |
| InChIKey | GVPLRATUWIBZMI-KQEUJGLLSA-N |
| XLogP | 5.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|