C22H32O3 — CID 20716888
(2S,10S,11S,14R,15S,17R)-14-ethyl-14-hydroxy-2,4,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one (PubChem CID 20716888) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2S,10S,11S,14R,15S,17R)-14-ethyl-14-hydroxy-2,4,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one.
| Compound Name | (2S,10S,11S,14R,15S,17R)-14-ethyl-14-hydroxy-2,4,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one |
|---|---|
| PubChem CID | 20716888 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2S,10S,11S,14R,15S,17R)-14-ethyl-14-hydroxy-2,4,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one |
| SMILES | CC[C@@]1(O)CC[C@H]2C3CCC4=CC(=O)C(C)C[C@]4(C)C34O[C@@H]4C[C@@]21C |
| InChI | InChI=1S/C22H32O3/c1-5-21(24)9-8-15-16-7-6-14-10-17(23)13(2)11-19(14,3)22(16)18(25-22)12-20(15,21)4/h10,13,15-16,18,24H,5-9,11-12H2,1-4H3/t13?,15-,16?,18+,19-,20-,21+,22?/m0/s1 |
| InChIKey | JOYNPFVFGIJWTF-OTJUWAKISA-N |
| XLogP | 4.04 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|