C21H30O3 — CID 99568462
(1R,2S,4S,10S,11S,14R,15S,17S)-14-hydroxy-2,4,14,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one (PubChem CID 99568462) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (1R,2S,4S,10S,11S,14R,15S,17S)-14-hydroxy-2,4,14,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one.
| Compound Name | (1R,2S,4S,10S,11S,14R,15S,17S)-14-hydroxy-2,4,14,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one |
|---|---|
| PubChem CID | 99568462 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1R,2S,4S,10S,11S,14R,15S,17S)-14-hydroxy-2,4,14,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-5-one |
| SMILES | C[C@H]1C[C@@]2(C)C(=CC1=O)CC[C@H]1[C@@H]3CC[C@@](C)(O)[C@@]3(C)C[C@@H]3O[C@]312 |
| InChI | InChI=1S/C21H30O3/c1-12-10-18(2)13(9-16(12)22)5-6-15-14-7-8-20(4,23)19(14,3)11-17-21(15,18)24-17/h9,12,14-15,17,23H,5-8,10-11H2,1-4H3/t12-,14-,15-,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | BAEFASBRYLYOEE-ZOURKWAFSA-N |
| XLogP | 3.65 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|