C23H30O5 — CID 91288101
[(8S,10S,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate (PubChem CID 91288101) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is [(8S,10S,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate.
| Compound Name | [(8S,10S,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 91288101 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(8S,10S,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@@]2(C)C(=CC1=O)CC[C@@H]1C2=CC[C@@]2(C)[C@H]1CC[C@]2(O)C(C)=O |
| InChI | InChI=1S/C23H30O5/c1-13(24)23(27)10-8-18-16-6-5-15-11-19(26)20(28-14(2)25)12-21(15,3)17(16)7-9-22(18,23)4/h7,11,16,18,20,27H,5-6,8-10,12H2,1-4H3/t16-,18+,20?,21+,22+,23+/m1/s1 |
| InChIKey | NDCIIEACITYMPS-QQQOGLMKSA-N |
| XLogP | 3.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|