About (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide
(2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide (PubChem CID 101028550) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide.
Molecular Properties
| Compound Name | (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide |
| PubChem CID | 101028550 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide |
| SMILES | CCN(CC)C(=O)/C=C1/CCCO1 |
| InChI | InChI=1S/C10H17NO2/c1-3-11(4-2)10(12)8-9-6-5-7-13-9/h8H,3-7H2,1-2H3/b9-8- |
| InChIKey | GFXYVIVXLKEUJK-HJWRWDBZSA-N |
| XLogP | 1.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide?
The IUPAC name of (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide (CID 101028550) is (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide.
What is the SMILES notation for (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide?
The canonical SMILES for (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide is CCN(CC)C(=O)/C=C1/CCCO1.
What is the InChIKey of (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide?
The InChIKey is GFXYVIVXLKEUJK-HJWRWDBZSA-N. The full InChI is InChI=1S/C10H17NO2/c1-3-11(4-2)10(12)8-9-6-5-7-13-9/h8H,3-7H2,1-2H3/b9-8-.
What are the key properties of (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide?
(2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide has a molecular weight of 183.25 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N,N-diethyl-2-(oxolan-2-ylidene)acetamide is sourced from PubChem (CID 101028550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).