C19H26O2 — CID 101028575
ethyl 1-dec-9-en-2,5-diynylcyclohexane-1-carboxylate (PubChem CID 101028575) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is ethyl 1-dec-9-en-2,5-diynylcyclohexane-1-carboxylate.
| Compound Name | ethyl 1-dec-9-en-2,5-diynylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101028575 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | ethyl 1-dec-9-en-2,5-diynylcyclohexane-1-carboxylate |
| SMILES | C=CCCC#CCC#CCC1(C(=O)OCC)CCCCC1 |
| InChI | InChI=1S/C19H26O2/c1-3-5-6-7-8-9-10-12-15-19(18(20)21-4-2)16-13-11-14-17-19/h3H,1,4-6,9,11,13-17H2,2H3 |
| InChIKey | ZQCUHZGRIZQVIX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|